C9H11F6N — CID 121451036
2-methyl-3-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]azetidine (PubChem CID 121451036) has the molecular formula C9H11F6N and a molecular weight of 247.18 g/mol. Its IUPAC name is 2-methyl-3-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]azetidine.
| Compound Name | 2-methyl-3-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]azetidine |
|---|---|
| PubChem CID | 121451036 |
| Molecular Formula | C9H11F6N |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-methyl-3-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]azetidine |
| SMILES | CC1NCC1CC=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11F6N/c1-5-6(4-16-5)2-3-7(8(10,11)12)9(13,14)15/h3,5-6,16H,2,4H2,1H3 |
| InChIKey | XERYPXSMGMVFLY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|