C10H13F6N — CID 121450917
2-methyl-3-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrrolidine (PubChem CID 121450917) has the molecular formula C10H13F6N and a molecular weight of 261.21 g/mol. Its IUPAC name is 2-methyl-3-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrrolidine.
| Compound Name | 2-methyl-3-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrrolidine |
|---|---|
| PubChem CID | 121450917 |
| Molecular Formula | C10H13F6N |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-methyl-3-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrrolidine |
| SMILES | CC1NCCC1CC=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6N/c1-6-7(4-5-17-6)2-3-8(9(11,12)13)10(14,15)16/h3,6-7,17H,2,4-5H2,1H3 |
| InChIKey | KBLITXPCZWDLHN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|