C9H13F4N — CID 130787792
2-[2-fluoro-3-(trifluoromethyl)but-3-en-2-yl]pyrrolidine (PubChem CID 130787792) has the molecular formula C9H13F4N and a molecular weight of 211.20 g/mol. Its IUPAC name is 2-[2-fluoro-3-(trifluoromethyl)but-3-en-2-yl]pyrrolidine.
| Compound Name | 2-[2-fluoro-3-(trifluoromethyl)but-3-en-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 130787792 |
| Molecular Formula | C9H13F4N |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-[2-fluoro-3-(trifluoromethyl)but-3-en-2-yl]pyrrolidine |
| SMILES | C=C(C(F)(F)F)C(C)(F)C1CCCN1 |
| InChI | InChI=1S/C9H13F4N/c1-6(9(11,12)13)8(2,10)7-4-3-5-14-7/h7,14H,1,3-5H2,2H3 |
| InChIKey | HTOHRFPIXHDDMQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|