C10H13F6N — CID 121451030
2-[5,5,5-trifluoro-4-(trifluoromethyl)pent-3-enyl]pyrrolidine (PubChem CID 121451030) has the molecular formula C10H13F6N and a molecular weight of 261.21 g/mol. Its IUPAC name is 2-[5,5,5-trifluoro-4-(trifluoromethyl)pent-3-enyl]pyrrolidine.
| Compound Name | 2-[5,5,5-trifluoro-4-(trifluoromethyl)pent-3-enyl]pyrrolidine |
|---|---|
| PubChem CID | 121451030 |
| Molecular Formula | C10H13F6N |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[5,5,5-trifluoro-4-(trifluoromethyl)pent-3-enyl]pyrrolidine |
| SMILES | FC(F)(F)C(=CCCC1CCCN1)C(F)(F)F |
| InChI | InChI=1S/C10H13F6N/c11-9(12,13)8(10(14,15)16)5-1-3-7-4-2-6-17-7/h5,7,17H,1-4,6H2 |
| InChIKey | MDCYJYOWJKSJID-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|