C7H8F3N — CID 153386497
(1S,4R)-2-(trifluoromethyl)-7-azabicyclo[2.2.1]hept-2-ene (PubChem CID 153386497) has the molecular formula C7H8F3N and a molecular weight of 163.14 g/mol. Its IUPAC name is (1S,4R)-2-(trifluoromethyl)-7-azabicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R)-2-(trifluoromethyl)-7-azabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 153386497 |
| Molecular Formula | C7H8F3N |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (1S,4R)-2-(trifluoromethyl)-7-azabicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1=C[C@H]2CC[C@@H]1N2 |
| InChI | InChI=1S/C7H8F3N/c8-7(9,10)5-3-4-1-2-6(5)11-4/h3-4,6,11H,1-2H2/t4-,6+/m1/s1 |
| InChIKey | QGUNJLMWKLCKHI-XINAWCOVSA-N |
| XLogP | 1.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|