C10H14FN — CID 143944881
2-(6-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine (PubChem CID 143944881) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 2-(6-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine.
| Compound Name | 2-(6-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine |
|---|---|
| PubChem CID | 143944881 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-(6-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine |
| SMILES | FC1=CCCC=C1C1CCCN1 |
| InChI | InChI=1S/C10H14FN/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h4-5,10,12H,1-3,6-7H2 |
| InChIKey | OTKVKGQHOWOXAM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |