C10H17F2N — CID 177213219
(2R,5S)-2-(2,2-difluoroethenyl)-2,5-diethylpyrrolidine (PubChem CID 177213219) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is (2R,5S)-2-(2,2-difluoroethenyl)-2,5-diethylpyrrolidine.
| Compound Name | (2R,5S)-2-(2,2-difluoroethenyl)-2,5-diethylpyrrolidine |
|---|---|
| PubChem CID | 177213219 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (2R,5S)-2-(2,2-difluoroethenyl)-2,5-diethylpyrrolidine |
| SMILES | CC[C@H]1CC[C@@](C=C(F)F)(CC)N1 |
| InChI | InChI=1S/C10H17F2N/c1-3-8-5-6-10(4-2,13-8)7-9(11)12/h7-8,13H,3-6H2,1-2H3/t8-,10+/m0/s1 |
| InChIKey | HNPOMOCYLXWOST-WCBMZHEXSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |