C11H11NO5 — CID 121468946
3-cyclohex-2-en-1-yl-5-nitrofuran-2-carboxylic acid (PubChem CID 121468946) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 3-cyclohex-2-en-1-yl-5-nitrofuran-2-carboxylic acid.
| Compound Name | 3-cyclohex-2-en-1-yl-5-nitrofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 121468946 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-cyclohex-2-en-1-yl-5-nitrofuran-2-carboxylic acid |
| SMILES | O=C(O)c1oc([N+](=O)[O-])cc1C1C=CCCC1 |
| InChI | InChI=1S/C11H11NO5/c13-11(14)10-8(6-9(17-10)12(15)16)7-4-2-1-3-5-7/h2,4,6-7H,1,3,5H2,(H,13,14) |
| InChIKey | LBYAPPOVBMXHLR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|