C27H33N3O3S — CID 121469256
2-[4-(dibutylamino)-3-[(4-methylphenyl)carbamoylamino]phenyl]thiophene-3-carboxylic acid (PubChem CID 121469256) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is 2-[4-(dibutylamino)-3-[(4-methylphenyl)carbamoylamino]phenyl]thiophene-3-carboxylic acid.
| Compound Name | 2-[4-(dibutylamino)-3-[(4-methylphenyl)carbamoylamino]phenyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 121469256 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[4-(dibutylamino)-3-[(4-methylphenyl)carbamoylamino]phenyl]thiophene-3-carboxylic acid |
| SMILES | CCCCN(CCCC)c1ccc(-c2sccc2C(=O)O)cc1NC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C27H33N3O3S/c1-4-6-15-30(16-7-5-2)24-13-10-20(25-22(26(31)32)14-17-34-25)18-23(24)29-27(33)28-21-11-8-19(3)9-12-21/h8-14,17-18H,4-7,15-16H2,1-3H3,(H,31,32)(H2,28,29,33) |
| InChIKey | VIGNBXWQORZRAO-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |