C25H16ClF2NO3 — CID 121470718
4-[3-(2-chloro-6-cyclopropylbenzoyl)-7-fluoroindol-1-yl]-3-fluorobenzoic acid (PubChem CID 121470718) has the molecular formula C25H16ClF2NO3 and a molecular weight of 451.86 g/mol. Its IUPAC name is 4-[3-(2-chloro-6-cyclopropylbenzoyl)-7-fluoroindol-1-yl]-3-fluorobenzoic acid.
| Compound Name | 4-[3-(2-chloro-6-cyclopropylbenzoyl)-7-fluoroindol-1-yl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 121470718 |
| Molecular Formula | C25H16ClF2NO3 |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 4-[3-(2-chloro-6-cyclopropylbenzoyl)-7-fluoroindol-1-yl]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(-n2cc(C(=O)c3c(Cl)cccc3C3CC3)c3cccc(F)c32)c(F)c1 |
| InChI | InChI=1S/C25H16ClF2NO3/c26-18-5-1-3-15(13-7-8-13)22(18)24(30)17-12-29(23-16(17)4-2-6-19(23)27)21-10-9-14(25(31)32)11-20(21)28/h1-6,9-13H,7-8H2,(H,31,32) |
| InChIKey | BWEYKQDCLHEKOB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |