C20H17F3N2O2 — CID 121470833
4-[(2-methyl-3-oxocyclopenten-1-yl)amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 121470833) has the molecular formula C20H17F3N2O2 and a molecular weight of 374.36 g/mol. Its IUPAC name is 4-[(2-methyl-3-oxocyclopenten-1-yl)amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[(2-methyl-3-oxocyclopenten-1-yl)amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 121470833 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-[(2-methyl-3-oxocyclopenten-1-yl)amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC1=C(Nc2ccc(C(=O)Nc3cccc(C(F)(F)F)c3)cc2)CCC1=O |
| InChI | InChI=1S/C20H17F3N2O2/c1-12-17(9-10-18(12)26)24-15-7-5-13(6-8-15)19(27)25-16-4-2-3-14(11-16)20(21,22)23/h2-8,11,24H,9-10H2,1H3,(H,25,27) |
| InChIKey | GPDBRPIICCXXDE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |