C17H11F4N3O2 — CID 121471074
3-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,5-a]benzimidazol-1-one (PubChem CID 121471074) has the molecular formula C17H11F4N3O2 and a molecular weight of 365.29 g/mol. Its IUPAC name is 3-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,5-a]benzimidazol-1-one.
| Compound Name | 3-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,5-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 121471074 |
| Molecular Formula | C17H11F4N3O2 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 3-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,5-a]benzimidazol-1-one |
| SMILES | COc1c(F)c(F)c(CC2NC(=O)n3c2nc2ccccc23)c(F)c1F |
| InChI | InChI=1S/C17H11F4N3O2/c1-26-15-13(20)11(18)7(12(19)14(15)21)6-9-16-22-8-4-2-3-5-10(8)24(16)17(25)23-9/h2-5,9H,6H2,1H3,(H,23,25) |
| InChIKey | KQRHFMWLPOXMGJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|