C12H13N3S2 — CID 16642156
3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione (PubChem CID 16642156) has the molecular formula C12H13N3S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione.
| Compound Name | 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione |
|---|---|
| PubChem CID | 16642156 |
| Molecular Formula | C12H13N3S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione |
| SMILES | CSCCC1NC(=S)n2c1nc1ccccc12 |
| InChI | InChI=1S/C12H13N3S2/c1-17-7-6-9-11-13-8-4-2-3-5-10(8)15(11)12(16)14-9/h2-5,9H,6-7H2,1H3,(H,14,16) |
| InChIKey | PKRMUVVMFYWNLT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|