About 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione
3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione (PubChem CID 16642156) has the molecular formula C12H13N3S2
and a molecular weight of 263.39 g/mol. Its IUPAC name is 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione.
Molecular Properties
| Compound Name | 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione |
| PubChem CID | 16642156 |
| Molecular Formula | C12H13N3S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione |
| SMILES | CSCCC1NC(=S)n2c1nc1ccccc12 |
| InChI | InChI=1S/C12H13N3S2/c1-17-7-6-9-11-13-8-4-2-3-5-10(8)15(11)12(16)14-9/h2-5,9H,6-7H2,1H3,(H,14,16) |
| InChIKey | PKRMUVVMFYWNLT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione?
The IUPAC name of 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione (CID 16642156) is 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione.
What is the SMILES notation for 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione?
The canonical SMILES for 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione is CSCCC1NC(=S)n2c1nc1ccccc12.
What is the InChIKey of 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione?
The InChIKey is PKRMUVVMFYWNLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3S2/c1-17-7-6-9-11-13-8-4-2-3-5-10(8)15(11)12(16)14-9/h2-5,9H,6-7H2,1H3,(H,14,16).
What are the key properties of 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione?
3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione has a molecular weight of 263.39 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylsulfanylethyl)-2,3-dihydroimidazo[1,5-a]benzimidazole-1-thione is sourced from PubChem (CID 16642156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).