C34H30Cl2N4O2 — CID 121471608
4-[[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]methyl]benzoic acid (PubChem CID 121471608) has the molecular formula C34H30Cl2N4O2 and a molecular weight of 597.55 g/mol. Its IUPAC name is 4-[[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 121471608 |
| Molecular Formula | C34H30Cl2N4O2 |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 4-[[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCC(Nc3cnnc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C34H30Cl2N4O2/c35-27-10-5-23(6-11-27)33(24-7-12-28(36)13-8-24)26-9-14-31-30(19-26)32(20-37-39-31)38-29-15-17-40(18-16-29)21-22-1-3-25(4-2-22)34(41)42/h1-14,19-20,29,33H,15-18,21H2,(H,38,39)(H,41,42) |
| InChIKey | QIQJHMYPKICBEN-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|