C33H28Cl2N4O4S — CID 121471777
4-[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 121471777) has the molecular formula C33H28Cl2N4O4S and a molecular weight of 647.58 g/mol. Its IUPAC name is 4-[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 121471777 |
| Molecular Formula | C33H28Cl2N4O4S |
| Molecular Weight | 647.58 g/mol |
| Exact Mass | 646.12 |
| IUPAC Name | 4-[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCC(Nc3cnnc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C33H28Cl2N4O4S/c34-25-8-1-21(2-9-25)32(22-3-10-26(35)11-4-22)24-7-14-30-29(19-24)31(20-36-38-30)37-27-15-17-39(18-16-27)44(42,43)28-12-5-23(6-13-28)33(40)41/h1-14,19-20,27,32H,15-18H2,(H,37,38)(H,40,41) |
| InChIKey | ZFRAZLYVFXGQBV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.58 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|