C32H28Cl2N4O2S — CID 121471761
5-[[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]methyl]thiophene-2-carboxylic acid (PubChem CID 121471761) has the molecular formula C32H28Cl2N4O2S and a molecular weight of 603.58 g/mol. Its IUPAC name is 5-[[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 121471761 |
| Molecular Formula | C32H28Cl2N4O2S |
| Molecular Weight | 603.58 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 5-[[4-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]piperidin-1-yl]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CN2CCC(Nc3cnnc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)CC2)s1 |
| InChI | InChI=1S/C32H28Cl2N4O2S/c33-23-6-1-20(2-7-23)31(21-3-8-24(34)9-4-21)22-5-11-28-27(17-22)29(18-35-37-28)36-25-13-15-38(16-14-25)19-26-10-12-30(41-26)32(39)40/h1-12,17-18,25,31H,13-16,19H2,(H,36,37)(H,39,40) |
| InChIKey | IMCXQAMQWKXBIV-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.58 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|