C34H31Cl2N3O2S — CID 126617172
5-[[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]thiophene-2-carboxylic acid (PubChem CID 126617172) has the molecular formula C34H31Cl2N3O2S and a molecular weight of 616.61 g/mol. Its IUPAC name is 5-[[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 126617172 |
| Molecular Formula | C34H31Cl2N3O2S |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | 5-[[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CN2CCC(c3nn(C4CC4)c4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)CC2)s1 |
| InChI | InChI=1S/C34H31Cl2N3O2S/c35-25-6-1-21(2-7-25)32(22-3-8-26(36)9-4-22)24-5-13-30-29(19-24)33(37-39(30)27-10-11-27)23-15-17-38(18-16-23)20-28-12-14-31(42-28)34(40)41/h1-9,12-14,19,23,27,32H,10-11,15-18,20H2,(H,40,41) |
| InChIKey | RUCTXBXENREYKI-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|