C35H31Cl2N3O4S — CID 126616868
4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 126616868) has the molecular formula C35H31Cl2N3O4S and a molecular weight of 660.62 g/mol. Its IUPAC name is 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 126616868 |
| Molecular Formula | C35H31Cl2N3O4S |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCC(c3c4cc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)ccc4nn3C3CC3)CC2)cc1 |
| InChI | InChI=1S/C35H31Cl2N3O4S/c36-27-8-1-22(2-9-27)33(23-3-10-28(37)11-4-23)26-7-16-32-31(21-26)34(40(38-32)29-12-13-29)24-17-19-39(20-18-24)45(43,44)30-14-5-25(6-15-30)35(41)42/h1-11,14-16,21,24,29,33H,12-13,17-20H2,(H,41,42) |
| InChIKey | SAHBYJFTZSPAIY-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|