C27H23ClF4N4O3S — CID 121471611
(4-chlorophenyl)-(4-fluorophenyl)-[4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]cinnolin-6-yl]methanol (PubChem CID 121471611) has the molecular formula C27H23ClF4N4O3S and a molecular weight of 595.02 g/mol. Its IUPAC name is (4-chlorophenyl)-(4-fluorophenyl)-[4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]cinnolin-6-yl]methanol.
| Compound Name | (4-chlorophenyl)-(4-fluorophenyl)-[4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]cinnolin-6-yl]methanol |
|---|---|
| PubChem CID | 121471611 |
| Molecular Formula | C27H23ClF4N4O3S |
| Molecular Weight | 595.02 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | (4-chlorophenyl)-(4-fluorophenyl)-[4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]cinnolin-6-yl]methanol |
| SMILES | O=S(=O)(N1CCC(Nc2cnnc3ccc(C(O)(c4ccc(F)cc4)c4ccc(Cl)cc4)cc23)CC1)C(F)(F)F |
| InChI | InChI=1S/C27H23ClF4N4O3S/c28-20-6-1-17(2-7-20)26(37,18-3-8-21(29)9-4-18)19-5-10-24-23(15-19)25(16-33-35-24)34-22-11-13-36(14-12-22)40(38,39)27(30,31)32/h1-10,15-16,22,37H,11-14H2,(H,34,35) |
| InChIKey | QRKWNELXLUDCLF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.02 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|