C31H26Cl2N4O2S — CID 121471708
N-[1-(benzenesulfonyl)pyrrolidin-3-yl]-6-[bis(4-chlorophenyl)methyl]cinnolin-4-amine (PubChem CID 121471708) has the molecular formula C31H26Cl2N4O2S and a molecular weight of 589.55 g/mol. Its IUPAC name is N-[1-(benzenesulfonyl)pyrrolidin-3-yl]-6-[bis(4-chlorophenyl)methyl]cinnolin-4-amine.
| Compound Name | N-[1-(benzenesulfonyl)pyrrolidin-3-yl]-6-[bis(4-chlorophenyl)methyl]cinnolin-4-amine |
|---|---|
| PubChem CID | 121471708 |
| Molecular Formula | C31H26Cl2N4O2S |
| Molecular Weight | 589.55 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | N-[1-(benzenesulfonyl)pyrrolidin-3-yl]-6-[bis(4-chlorophenyl)methyl]cinnolin-4-amine |
| SMILES | O=S(=O)(c1ccccc1)N1CCC(Nc2cnnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)C1 |
| InChI | InChI=1S/C31H26Cl2N4O2S/c32-24-11-6-21(7-12-24)31(22-8-13-25(33)14-9-22)23-10-15-29-28(18-23)30(19-34-36-29)35-26-16-17-37(20-26)40(38,39)27-4-2-1-3-5-27/h1-15,18-19,26,31H,16-17,20H2,(H,35,36) |
| InChIKey | HQIWAAVSUNLEAO-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.55 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|