C19H22BrClN2O2 — CID 121473200
1-(4-bromo-3-ethylphenyl)-1-(2-chloroethyl)-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 121473200) has the molecular formula C19H22BrClN2O2 and a molecular weight of 425.75 g/mol. Its IUPAC name is 1-(4-bromo-3-ethylphenyl)-1-(2-chloroethyl)-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-(4-bromo-3-ethylphenyl)-1-(2-chloroethyl)-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 121473200 |
| Molecular Formula | C19H22BrClN2O2 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 1-(4-bromo-3-ethylphenyl)-1-(2-chloroethyl)-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | CCc1cc(N(CCCl)C(=O)NCc2cccc(OC)c2)ccc1Br |
| InChI | InChI=1S/C19H22BrClN2O2/c1-3-15-12-16(7-8-18(15)20)23(10-9-21)19(24)22-13-14-5-4-6-17(11-14)25-2/h4-8,11-12H,3,9-10,13H2,1-2H3,(H,22,24) |
| InChIKey | ZFRQKSSARXFRCG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|