C20H26BrN3O2 — CID 71654971
1-(4-bromophenyl)-1-[3-(dimethylamino)propyl]-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 71654971) has the molecular formula C20H26BrN3O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-[3-(dimethylamino)propyl]-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-(4-bromophenyl)-1-[3-(dimethylamino)propyl]-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 71654971 |
| Molecular Formula | C20H26BrN3O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-(4-bromophenyl)-1-[3-(dimethylamino)propyl]-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)N(CCCN(C)C)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H26BrN3O2/c1-23(2)12-5-13-24(18-10-8-17(21)9-11-18)20(25)22-15-16-6-4-7-19(14-16)26-3/h4,6-11,14H,5,12-13,15H2,1-3H3,(H,22,25) |
| InChIKey | OYVWCHVSVKJDPN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |