C20H23F2NO4 — CID 121475775
methyl (1R,3aR,6S,7R,7aS)-5,5-difluoro-1,6-dimethyl-7-[(E)-2-(5-methyl-2-pyridinyl)ethenyl]-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carboxylate (PubChem CID 121475775) has the molecular formula C20H23F2NO4 and a molecular weight of 379.40 g/mol. Its IUPAC name is methyl (1R,3aR,6S,7R,7aS)-5,5-difluoro-1,6-dimethyl-7-[(E)-2-(5-methyl-2-pyridinyl)ethenyl]-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carboxylate.
| Compound Name | methyl (1R,3aR,6S,7R,7aS)-5,5-difluoro-1,6-dimethyl-7-[(E)-2-(5-methyl-2-pyridinyl)ethenyl]-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carboxylate |
|---|---|
| PubChem CID | 121475775 |
| Molecular Formula | C20H23F2NO4 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | methyl (1R,3aR,6S,7R,7aS)-5,5-difluoro-1,6-dimethyl-7-[(E)-2-(5-methyl-2-pyridinyl)ethenyl]-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CC(F)(F)[C@@H](C)[C@H](/C=C/c3ccc(C)cn3)[C@@H]1[C@@H](C)OC2=O |
| InChI | InChI=1S/C20H23F2NO4/c1-11-5-6-14(23-9-11)7-8-15-12(2)20(21,22)10-19(17(24)26-4)16(15)13(3)27-18(19)25/h5-9,12-13,15-16H,10H2,1-4H3/b8-7+/t12-,13+,15-,16-,19+/m0/s1 |
| InChIKey | JGUBZWBZHKICEB-QAKJQOGTSA-N |
| XLogP | 3.42 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|