C19H18F8 — CID 121476186
1-but-3-enyl-5,5,6,6-tetrafluoro-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene (PubChem CID 121476186) has the molecular formula C19H18F8 and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-but-3-enyl-5,5,6,6-tetrafluoro-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene.
| Compound Name | 1-but-3-enyl-5,5,6,6-tetrafluoro-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476186 |
| Molecular Formula | C19H18F8 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-but-3-enyl-5,5,6,6-tetrafluoro-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
| SMILES | C=CCCC1=CC=C(C2=CC=C(CCC)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C19H18F8/c1-3-5-7-13-9-11-15(19(26,27)17(13,22)23)14-10-8-12(6-4-2)16(20,21)18(14,24)25/h3,8-11H,1,4-7H2,2H3 |
| InChIKey | PRDVFCIXDIXPSN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|