C20H20Cl2FN7O — CID 121478266
5-(azetidin-3-ylmethyl)-3-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]-1,2,4-oxadiazole (PubChem CID 121478266) has the molecular formula C20H20Cl2FN7O and a molecular weight of 464.33 g/mol. Its IUPAC name is 5-(azetidin-3-ylmethyl)-3-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-(azetidin-3-ylmethyl)-3-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 121478266 |
| Molecular Formula | C20H20Cl2FN7O |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 5-(azetidin-3-ylmethyl)-3-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]-1,2,4-oxadiazole |
| SMILES | C[C@H](c1c(Cl)ccc(F)c1Cl)N1CCNc2nnc(-c3noc(CC4CNC4)n3)cc21 |
| InChI | InChI=1S/C20H20Cl2FN7O/c1-10(17-12(21)2-3-13(23)18(17)22)30-5-4-25-20-15(30)7-14(27-28-20)19-26-16(31-29-19)6-11-8-24-9-11/h2-3,7,10-11,24H,4-6,8-9H2,1H3,(H,25,28)/t10-/m1/s1 |
| InChIKey | ZYKFIIUVSRYGPN-SNVBAGLBSA-N |
| XLogP | 3.73 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|