C29H25F3N6O4S — CID 121479954
1-[3-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]sulfanylphenyl]-3-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]urea (PubChem CID 121479954) has the molecular formula C29H25F3N6O4S and a molecular weight of 610.62 g/mol. Its IUPAC name is 1-[3-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]sulfanylphenyl]-3-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]urea.
| Compound Name | 1-[3-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]sulfanylphenyl]-3-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 121479954 |
| Molecular Formula | C29H25F3N6O4S |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 1-[3-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]sulfanylphenyl]-3-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]urea |
| SMILES | COCCOc1cc2ncnc(Sc3cccc(NC(=O)Nc4cc(C(F)(F)F)nn4-c4ccccc4)c3)c2cc1OC |
| InChI | InChI=1S/C29H25F3N6O4S/c1-40-11-12-42-24-15-22-21(14-23(24)41-2)27(34-17-33-22)43-20-10-6-7-18(13-20)35-28(39)36-26-16-25(29(30,31)32)37-38(26)19-8-4-3-5-9-19/h3-10,13-17H,11-12H2,1-2H3,(H2,35,36,39) |
| InChIKey | QMGSECKEMJRJFC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|