C26H25F3N4O5S2 — CID 57413569
2-[2-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]sulfanyl-1,3-thiazol-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 57413569) has the molecular formula C26H25F3N4O5S2 and a molecular weight of 594.64 g/mol. Its IUPAC name is 2-[2-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]sulfanyl-1,3-thiazol-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]sulfanyl-1,3-thiazol-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 57413569 |
| Molecular Formula | C26H25F3N4O5S2 |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | 2-[2-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]sulfanyl-1,3-thiazol-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCOc1cc2ncnc(Sc3ncc(CC(=O)Nc4cccc(C(F)(F)F)c4)s3)c2cc1OCCOC |
| InChI | InChI=1S/C26H25F3N4O5S2/c1-35-6-8-37-21-12-19-20(13-22(21)38-9-7-36-2)31-15-32-24(19)40-25-30-14-18(39-25)11-23(34)33-17-5-3-4-16(10-17)26(27,28)29/h3-5,10,12-15H,6-9,11H2,1-2H3,(H,33,34) |
| InChIKey | QDAJTTACVHWHMR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|