C28H27N5O5S — CID 121481006
4-[[1-[7-(3,4-dimethoxyanilino)-3-thia-5,8-diazatricyclo[7.1.1.02,6]undeca-1(10),2(6),4,7-tetraen-9-yl]pyrrolidin-3-yl]carbamoyl]benzoic acid (PubChem CID 121481006) has the molecular formula C28H27N5O5S and a molecular weight of 545.62 g/mol. Its IUPAC name is 4-[[1-[7-(3,4-dimethoxyanilino)-3-thia-5,8-diazatricyclo[7.1.1.02,6]undeca-1(10),2(6),4,7-tetraen-9-yl]pyrrolidin-3-yl]carbamoyl]benzoic acid.
| Compound Name | 4-[[1-[7-(3,4-dimethoxyanilino)-3-thia-5,8-diazatricyclo[7.1.1.02,6]undeca-1(10),2(6),4,7-tetraen-9-yl]pyrrolidin-3-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 121481006 |
| Molecular Formula | C28H27N5O5S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 4-[[1-[7-(3,4-dimethoxyanilino)-3-thia-5,8-diazatricyclo[7.1.1.02,6]undeca-1(10),2(6),4,7-tetraen-9-yl]pyrrolidin-3-yl]carbamoyl]benzoic acid |
| SMILES | COc1ccc(NC2=NC3(N4CCC(NC(=O)c5ccc(C(=O)O)cc5)C4)C=C(C3)c3scnc32)cc1OC |
| InChI | InChI=1S/C28H27N5O5S/c1-37-21-8-7-19(11-22(21)38-2)30-25-23-24(39-15-29-23)18-12-28(13-18,32-25)33-10-9-20(14-33)31-26(34)16-3-5-17(6-4-16)27(35)36/h3-8,11-12,15,20H,9-10,13-14H2,1-2H3,(H,30,32)(H,31,34)(H,35,36) |
| InChIKey | PWSVRBHYHXGZCG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |