C23H24FN3O2 — CID 121481142
(7R)-14-(4-fluorophenyl)-N,2-dimethyl-13-oxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(10),11,14,16-tetraene-15-carboxamide (PubChem CID 121481142) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is (7R)-14-(4-fluorophenyl)-N,2-dimethyl-13-oxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(10),11,14,16-tetraene-15-carboxamide.
| Compound Name | (7R)-14-(4-fluorophenyl)-N,2-dimethyl-13-oxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(10),11,14,16-tetraene-15-carboxamide |
|---|---|
| PubChem CID | 121481142 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (7R)-14-(4-fluorophenyl)-N,2-dimethyl-13-oxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(10),11,14,16-tetraene-15-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc3c(cc12)C(C)N1CCC[C@@H]1CN3 |
| InChI | InChI=1S/C23H24FN3O2/c1-13-17-10-18-20(11-19(17)26-12-16-4-3-9-27(13)16)29-22(21(18)23(28)25-2)14-5-7-15(24)8-6-14/h5-8,10-11,13,16,26H,3-4,9,12H2,1-2H3,(H,25,28)/t13?,16-/m1/s1 |
| InChIKey | JTTYZSNWPDWIJT-FQNRMIAFSA-N |
| XLogP | 4.55 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |