C22H22FN3O6S — CID 121481130
8-(4-fluorophenyl)-7-N,5-dimethyl-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-3,7-dicarboxamide (PubChem CID 121481130) has the molecular formula C22H22FN3O6S and a molecular weight of 475.50 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-7-N,5-dimethyl-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-3,7-dicarboxamide.
| Compound Name | 8-(4-fluorophenyl)-7-N,5-dimethyl-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-3,7-dicarboxamide |
|---|---|
| PubChem CID | 121481130 |
| Molecular Formula | C22H22FN3O6S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 8-(4-fluorophenyl)-7-N,5-dimethyl-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-3,7-dicarboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc3c(cc12)C(C)OC(C(N)=O)CN3S(C)(=O)=O |
| InChI | InChI=1S/C22H22FN3O6S/c1-11-14-8-15-17(9-16(14)26(33(3,29)30)10-18(31-11)21(24)27)32-20(19(15)22(28)25-2)12-4-6-13(23)7-5-12/h4-9,11,18H,10H2,1-3H3,(H2,24,27)(H,25,28) |
| InChIKey | LVQDDJJICJUVNV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |