C24H28N2O6S — CID 157334738
(3S,5S)-3-(2-hydroxyethyl)-N,5-dimethyl-8-(4-methylphenyl)-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide (PubChem CID 157334738) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is (3S,5S)-3-(2-hydroxyethyl)-N,5-dimethyl-8-(4-methylphenyl)-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide.
| Compound Name | (3S,5S)-3-(2-hydroxyethyl)-N,5-dimethyl-8-(4-methylphenyl)-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 157334738 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (3S,5S)-3-(2-hydroxyethyl)-N,5-dimethyl-8-(4-methylphenyl)-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2cc3c(cc12)[C@H](C)O[C@@H](CCO)CN3S(C)(=O)=O |
| InChI | InChI=1S/C24H28N2O6S/c1-14-5-7-16(8-6-14)23-22(24(28)25-3)19-11-18-15(2)31-17(9-10-27)13-26(33(4,29)30)20(18)12-21(19)32-23/h5-8,11-12,15,17,27H,9-10,13H2,1-4H3,(H,25,28)/t15-,17-/m0/s1 |
| InChIKey | WAKDQYJJRREZCA-RDJZCZTQSA-N |
| XLogP | 3.38 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |