C23H25FN2O6S2 — CID 70801041
(3S,5S)-8-(4-fluorophenyl)-N,5-dimethyl-3-[[(S)-methylsulfinyl]methyl]-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide (PubChem CID 70801041) has the molecular formula C23H25FN2O6S2 and a molecular weight of 508.59 g/mol. Its IUPAC name is (3S,5S)-8-(4-fluorophenyl)-N,5-dimethyl-3-[[(S)-methylsulfinyl]methyl]-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide.
| Compound Name | (3S,5S)-8-(4-fluorophenyl)-N,5-dimethyl-3-[[(S)-methylsulfinyl]methyl]-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 70801041 |
| Molecular Formula | C23H25FN2O6S2 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | (3S,5S)-8-(4-fluorophenyl)-N,5-dimethyl-3-[[(S)-methylsulfinyl]methyl]-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc3c(cc12)[C@H](C)O[C@H](C[S@](C)=O)CN3S(C)(=O)=O |
| InChI | InChI=1S/C23H25FN2O6S2/c1-13-17-9-18-20(10-19(17)26(34(4,29)30)11-16(31-13)12-33(3)28)32-22(21(18)23(27)25-2)14-5-7-15(24)8-6-14/h5-10,13,16H,11-12H2,1-4H3,(H,25,27)/t13-,16-,33-/m0/s1 |
| InChIKey | HXTLXBKIKUENAG-KMRSVAAPSA-N |
| XLogP | 3.20 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |