C29H29FN2O8S2 — CID 70800873
(3R,5S)-8-[4-(4-fluorophenoxy)phenyl]-N,5-dimethyl-1-methylsulfonyl-3-(methylsulfonylmethyl)-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide (PubChem CID 70800873) has the molecular formula C29H29FN2O8S2 and a molecular weight of 616.69 g/mol. Its IUPAC name is (3R,5S)-8-[4-(4-fluorophenoxy)phenyl]-N,5-dimethyl-1-methylsulfonyl-3-(methylsulfonylmethyl)-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide.
| Compound Name | (3R,5S)-8-[4-(4-fluorophenoxy)phenyl]-N,5-dimethyl-1-methylsulfonyl-3-(methylsulfonylmethyl)-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 70800873 |
| Molecular Formula | C29H29FN2O8S2 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | (3R,5S)-8-[4-(4-fluorophenoxy)phenyl]-N,5-dimethyl-1-methylsulfonyl-3-(methylsulfonylmethyl)-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(Oc3ccc(F)cc3)cc2)oc2cc3c(cc12)[C@H](C)O[C@@H](CS(C)(=O)=O)CN3S(C)(=O)=O |
| InChI | InChI=1S/C29H29FN2O8S2/c1-17-23-13-24-26(14-25(23)32(42(4,36)37)15-22(38-17)16-41(3,34)35)40-28(27(24)29(33)31-2)18-5-9-20(10-6-18)39-21-11-7-19(30)8-12-21/h5-14,17,22H,15-16H2,1-4H3,(H,31,33)/t17-,22+/m0/s1 |
| InChIKey | RVMNGSJTAQHPQO-HTAPYJJXSA-N |
| XLogP | 4.66 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |