C28H27FN2O5S — CID 57330361
2-[4-(4-fluorophenoxy)phenyl]-N,5-dimethyl-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine-3-carboxamide (PubChem CID 57330361) has the molecular formula C28H27FN2O5S and a molecular weight of 522.60 g/mol. Its IUPAC name is 2-[4-(4-fluorophenoxy)phenyl]-N,5-dimethyl-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine-3-carboxamide.
| Compound Name | 2-[4-(4-fluorophenoxy)phenyl]-N,5-dimethyl-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine-3-carboxamide |
|---|---|
| PubChem CID | 57330361 |
| Molecular Formula | C28H27FN2O5S |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2-[4-(4-fluorophenoxy)phenyl]-N,5-dimethyl-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(Oc3ccc(F)cc3)cc2)oc2cc3c(cc12)C(C)CCCN3S(C)(=O)=O |
| InChI | InChI=1S/C28H27FN2O5S/c1-17-5-4-14-31(37(3,33)34)24-16-25-23(15-22(17)24)26(28(32)30-2)27(36-25)18-6-10-20(11-7-18)35-21-12-8-19(29)9-13-21/h6-13,15-17H,4-5,14H2,1-3H3,(H,30,32) |
| InChIKey | LIPZIHTVVBLXBP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |