C23H23FN2O5S — CID 69191034
(5S)-8-(4-fluorophenyl)-N,5-dimethyl-1-methylsulfonylspiro[2,5-dihydrofuro[3,2-h][4,1]benzoxazepine-3,1'-cyclopropane]-7-carboxamide (PubChem CID 69191034) has the molecular formula C23H23FN2O5S and a molecular weight of 458.51 g/mol. Its IUPAC name is (5S)-8-(4-fluorophenyl)-N,5-dimethyl-1-methylsulfonylspiro[2,5-dihydrofuro[3,2-h][4,1]benzoxazepine-3,1'-cyclopropane]-7-carboxamide.
| Compound Name | (5S)-8-(4-fluorophenyl)-N,5-dimethyl-1-methylsulfonylspiro[2,5-dihydrofuro[3,2-h][4,1]benzoxazepine-3,1'-cyclopropane]-7-carboxamide |
|---|---|
| PubChem CID | 69191034 |
| Molecular Formula | C23H23FN2O5S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (5S)-8-(4-fluorophenyl)-N,5-dimethyl-1-methylsulfonylspiro[2,5-dihydrofuro[3,2-h][4,1]benzoxazepine-3,1'-cyclopropane]-7-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc3c(cc12)[C@H](C)OC1(CC1)CN3S(C)(=O)=O |
| InChI | InChI=1S/C23H23FN2O5S/c1-13-16-10-17-19(11-18(16)26(32(3,28)29)12-23(31-13)8-9-23)30-21(20(17)22(27)25-2)14-4-6-15(24)7-5-14/h4-7,10-11,13H,8-9,12H2,1-3H3,(H,25,27)/t13-/m0/s1 |
| InChIKey | PIDBXHZRDRHTMU-ZDUSSCGKSA-N |
| XLogP | 3.99 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |