C24H28FN2O6PS — CID 70801045
(3S,5S)-3-(dimethylphosphorylmethyl)-8-(4-fluorophenyl)-N,5-dimethyl-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide (PubChem CID 70801045) has the molecular formula C24H28FN2O6PS and a molecular weight of 522.54 g/mol. Its IUPAC name is (3S,5S)-3-(dimethylphosphorylmethyl)-8-(4-fluorophenyl)-N,5-dimethyl-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide.
| Compound Name | (3S,5S)-3-(dimethylphosphorylmethyl)-8-(4-fluorophenyl)-N,5-dimethyl-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 70801045 |
| Molecular Formula | C24H28FN2O6PS |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (3S,5S)-3-(dimethylphosphorylmethyl)-8-(4-fluorophenyl)-N,5-dimethyl-1-methylsulfonyl-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc3c(cc12)[C@H](C)O[C@H](CP(C)(C)=O)CN3S(C)(=O)=O |
| InChI | InChI=1S/C24H28FN2O6PS/c1-14-18-10-19-21(33-23(22(19)24(28)26-2)15-6-8-16(25)9-7-15)11-20(18)27(35(5,30)31)12-17(32-14)13-34(3,4)29/h6-11,14,17H,12-13H2,1-5H3,(H,26,28)/t14-,17-/m0/s1 |
| InChIKey | DCRQYTIHEFOROX-YOEHRIQHSA-N |
| XLogP | 4.45 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|