C22H21FN2O4S — CID 88981652
5-(4-fluorophenyl)-15-methylsulfonyl-N-(trideuteriomethyl)-4-oxa-15-azatetracyclo[7.6.0.03,7.010,12]pentadeca-1(9),2,5,7-tetraene-6-carboxamide (PubChem CID 88981652) has the molecular formula C22H21FN2O4S and a molecular weight of 431.50 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-15-methylsulfonyl-N-(trideuteriomethyl)-4-oxa-15-azatetracyclo[7.6.0.03,7.010,12]pentadeca-1(9),2,5,7-tetraene-6-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-15-methylsulfonyl-N-(trideuteriomethyl)-4-oxa-15-azatetracyclo[7.6.0.03,7.010,12]pentadeca-1(9),2,5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 88981652 |
| Molecular Formula | C22H21FN2O4S |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 5-(4-fluorophenyl)-15-methylsulfonyl-N-(trideuteriomethyl)-4-oxa-15-azatetracyclo[7.6.0.03,7.010,12]pentadeca-1(9),2,5,7-tetraene-6-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1c(-c2ccc(F)cc2)oc2cc3c(cc12)C1CC1CCN3S(C)(=O)=O |
| InChI | InChI=1S/C22H21FN2O4S/c1-24-22(26)20-17-10-16-15-9-13(15)7-8-25(30(2,27)28)18(16)11-19(17)29-21(20)12-3-5-14(23)6-4-12/h3-6,10-11,13,15H,7-9H2,1-2H3,(H,24,26)/i1D3 |
| InChIKey | HQHFICNBZSKHED-FIBGUPNXSA-N |
| XLogP | 3.87 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |