C27H32N2O7S — CID 118241443
(3S,5S)-N,5-dimethyl-8-(4-methylphenyl)-1-methylsulfonyl-3-[[(3S)-oxolan-3-yl]oxymethyl]-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide (PubChem CID 118241443) has the molecular formula C27H32N2O7S and a molecular weight of 528.63 g/mol. Its IUPAC name is (3S,5S)-N,5-dimethyl-8-(4-methylphenyl)-1-methylsulfonyl-3-[[(3S)-oxolan-3-yl]oxymethyl]-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide.
| Compound Name | (3S,5S)-N,5-dimethyl-8-(4-methylphenyl)-1-methylsulfonyl-3-[[(3S)-oxolan-3-yl]oxymethyl]-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 118241443 |
| Molecular Formula | C27H32N2O7S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (3S,5S)-N,5-dimethyl-8-(4-methylphenyl)-1-methylsulfonyl-3-[[(3S)-oxolan-3-yl]oxymethyl]-3,5-dihydro-2H-furo[3,2-h][4,1]benzoxazepine-7-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2cc3c(cc12)[C@H](C)O[C@H](CO[C@H]1CCOC1)CN3S(C)(=O)=O |
| InChI | InChI=1S/C27H32N2O7S/c1-16-5-7-18(8-6-16)26-25(27(30)28-3)22-11-21-17(2)35-20(15-34-19-9-10-33-14-19)13-29(37(4,31)32)23(21)12-24(22)36-26/h5-8,11-12,17,19-20H,9-10,13-15H2,1-4H3,(H,28,30)/t17-,19-,20-/m0/s1 |
| InChIKey | OPWMDOLGUHCWTQ-IHPCNDPISA-N |
| XLogP | 3.80 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |