C23H26Cl2N4 — CID 121481893
1-[4-[(E)-2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]piperidin-4-amine;hydrochloride (PubChem CID 121481893) has the molecular formula C23H26Cl2N4 and a molecular weight of 429.40 g/mol. Its IUPAC name is 1-[4-[(E)-2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]piperidin-4-amine;hydrochloride.
| Compound Name | 1-[4-[(E)-2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 121481893 |
| Molecular Formula | C23H26Cl2N4 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[4-[(E)-2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]piperidin-4-amine;hydrochloride |
| SMILES | Cl.NC1CCN(c2ccc(/C=C/c3cc(Cl)cc(Cn4ccnc4)c3)cc2)CC1 |
| InChI | InChI=1S/C23H25ClN4.ClH/c24-21-14-19(13-20(15-21)16-27-12-9-26-17-27)2-1-18-3-5-23(6-4-18)28-10-7-22(25)8-11-28;/h1-6,9,12-15,17,22H,7-8,10-11,16,25H2;1H/b2-1+; |
| InChIKey | MJSSPPCFCXRPGT-TYYBGVCCSA-N |
| XLogP | 5.10 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|