C29H26ClF3N4OS — CID 123460160
1-[4-[2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]-4-[3-(trifluoromethoxy)phenyl]sulfanylpiperazine (PubChem CID 123460160) has the molecular formula C29H26ClF3N4OS and a molecular weight of 571.07 g/mol. Its IUPAC name is 1-[4-[2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]-4-[3-(trifluoromethoxy)phenyl]sulfanylpiperazine.
| Compound Name | 1-[4-[2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]-4-[3-(trifluoromethoxy)phenyl]sulfanylpiperazine |
|---|---|
| PubChem CID | 123460160 |
| Molecular Formula | C29H26ClF3N4OS |
| Molecular Weight | 571.07 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 1-[4-[2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]-4-[3-(trifluoromethoxy)phenyl]sulfanylpiperazine |
| SMILES | FC(F)(F)Oc1cccc(SN2CCN(c3ccc(C=Cc4cc(Cl)cc(Cn5ccnc5)c4)cc3)CC2)c1 |
| InChI | InChI=1S/C29H26ClF3N4OS/c30-25-17-23(16-24(18-25)20-35-11-10-34-21-35)5-4-22-6-8-26(9-7-22)36-12-14-37(15-13-36)39-28-3-1-2-27(19-28)38-29(31,32)33/h1-11,16-19,21H,12-15,20H2 |
| InChIKey | NTMBEBIMTPSDAR-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.07 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|