C30H28ClN5 — CID 123172480
3-[[4-[4-[2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 123172480) has the molecular formula C30H28ClN5 and a molecular weight of 494.04 g/mol. Its IUPAC name is 3-[[4-[4-[2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-[4-[2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 123172480 |
| Molecular Formula | C30H28ClN5 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3-[[4-[4-[2-[3-chloro-5-(imidazol-1-ylmethyl)phenyl]ethenyl]phenyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCN(c3ccc(C=Cc4cc(Cl)cc(Cn5ccnc5)c4)cc3)CC2)c1 |
| InChI | InChI=1S/C30H28ClN5/c31-29-18-25(16-28(19-29)22-35-11-10-33-23-35)5-4-24-6-8-30(9-7-24)36-14-12-34(13-15-36)21-27-3-1-2-26(17-27)20-32/h1-11,16-19,23H,12-15,21-22H2 |
| InChIKey | UICMTUOGJVCHFZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 48.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|