C9H9BrF2IN3O3 — CID 121487008
4-amino-1-[(2R,4R,5S)-5-(bromomethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]-5-iodopyrimidin-2-one (PubChem CID 121487008) has the molecular formula C9H9BrF2IN3O3 and a molecular weight of 451.99 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5S)-5-(bromomethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]-5-iodopyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4R,5S)-5-(bromomethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]-5-iodopyrimidin-2-one |
|---|---|
| PubChem CID | 121487008 |
| Molecular Formula | C9H9BrF2IN3O3 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 450.88 |
| IUPAC Name | 4-amino-1-[(2R,4R,5S)-5-(bromomethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]-5-iodopyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@@H]2O[C@H](CBr)[C@@H](O)C2(F)F)cc1I |
| InChI | InChI=1S/C9H9BrF2IN3O3/c10-1-4-5(17)9(11,12)7(19-4)16-2-3(13)6(14)15-8(16)18/h2,4-5,7,17H,1H2,(H2,14,15,18)/t4-,5-,7-/m1/s1 |
| InChIKey | GOADHIKXRAANHK-WYDQCIBASA-N |
| XLogP | 0.72 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|