C13H22N2S2 — CID 121495626
(1R,2S,6R,7S)-10-(1,4-dithiepan-6-yl)-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 121495626) has the molecular formula C13H22N2S2 and a molecular weight of 270.47 g/mol. Its IUPAC name is (1R,2S,6R,7S)-10-(1,4-dithiepan-6-yl)-4,10-diazatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,6R,7S)-10-(1,4-dithiepan-6-yl)-4,10-diazatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 121495626 |
| Molecular Formula | C13H22N2S2 |
| Molecular Weight | 270.47 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (1R,2S,6R,7S)-10-(1,4-dithiepan-6-yl)-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | C1CSCC(N2[C@@H]3CC[C@H]2[C@H]2CNC[C@H]23)CS1 |
| InChI | InChI=1S/C13H22N2S2/c1-2-13-11-6-14-5-10(11)12(1)15(13)9-7-16-3-4-17-8-9/h9-14H,1-8H2/t10-,11+,12-,13+ |
| InChIKey | XYXNRUMCRKKVAE-MPZDIEGVSA-N |
| XLogP | 1.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |