C11H22N2S — CID 130639744
2,6-dimethyl-1-(thian-4-yl)piperazine (PubChem CID 130639744) has the molecular formula C11H22N2S and a molecular weight of 214.38 g/mol. Its IUPAC name is 2,6-dimethyl-1-(thian-4-yl)piperazine.
| Compound Name | 2,6-dimethyl-1-(thian-4-yl)piperazine |
|---|---|
| PubChem CID | 130639744 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2,6-dimethyl-1-(thian-4-yl)piperazine |
| SMILES | CC1CNCC(C)N1C1CCSCC1 |
| InChI | InChI=1S/C11H22N2S/c1-9-7-12-8-10(2)13(9)11-3-5-14-6-4-11/h9-12H,3-8H2,1-2H3 |
| InChIKey | ZHAIRLMKTYRVCL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |