C10H15N7S — CID 121499107
[4-prop-2-enyl-5-[2-(1,2,4-triazol-4-yl)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine (PubChem CID 121499107) has the molecular formula C10H15N7S and a molecular weight of 265.35 g/mol. Its IUPAC name is [4-prop-2-enyl-5-[2-(1,2,4-triazol-4-yl)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-prop-2-enyl-5-[2-(1,2,4-triazol-4-yl)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 121499107 |
| Molecular Formula | C10H15N7S |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [4-prop-2-enyl-5-[2-(1,2,4-triazol-4-yl)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
| SMILES | C=CCn1c(CN)nnc1SCCn1cnnc1 |
| InChI | InChI=1S/C10H15N7S/c1-2-3-17-9(6-11)14-15-10(17)18-5-4-16-7-12-13-8-16/h2,7-8H,1,3-6,11H2 |
| InChIKey | IEKXDJOJBDLRHU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|