C23H27N3O2 — CID 121499610
9-[3-(2,6-dimethyl-3-pyridinyl)benzoyl]-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 121499610) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 9-[3-(2,6-dimethyl-3-pyridinyl)benzoyl]-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[3-(2,6-dimethyl-3-pyridinyl)benzoyl]-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 121499610 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 9-[3-(2,6-dimethyl-3-pyridinyl)benzoyl]-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | Cc1ccc(-c2cccc(C(=O)N3CCC4(CCC(=O)NC4)CC3)c2)c(C)n1 |
| InChI | InChI=1S/C23H27N3O2/c1-16-6-7-20(17(2)25-16)18-4-3-5-19(14-18)22(28)26-12-10-23(11-13-26)9-8-21(27)24-15-23/h3-7,14H,8-13,15H2,1-2H3,(H,24,27) |
| InChIKey | GHMKCJROAQQCGL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |