C21H24N2O3 — CID 126432118
(2R)-1-[3-(4-methoxy-2-methylphenyl)benzoyl]-2-methyl-1,4-diazepan-5-one (PubChem CID 126432118) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2R)-1-[3-(4-methoxy-2-methylphenyl)benzoyl]-2-methyl-1,4-diazepan-5-one.
| Compound Name | (2R)-1-[3-(4-methoxy-2-methylphenyl)benzoyl]-2-methyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 126432118 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (2R)-1-[3-(4-methoxy-2-methylphenyl)benzoyl]-2-methyl-1,4-diazepan-5-one |
| SMILES | COc1ccc(-c2cccc(C(=O)N3CCC(=O)NC[C@H]3C)c2)c(C)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-14-11-18(26-3)7-8-19(14)16-5-4-6-17(12-16)21(25)23-10-9-20(24)22-13-15(23)2/h4-8,11-12,15H,9-10,13H2,1-3H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | JGVACURWYWSMFF-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |