C21H25ClN2O4 — CID 154903926
methyl 5-methoxy-2-[3-(2-methylpiperazine-1-carbonyl)phenyl]benzoate;hydrochloride (PubChem CID 154903926) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is methyl 5-methoxy-2-[3-(2-methylpiperazine-1-carbonyl)phenyl]benzoate;hydrochloride.
| Compound Name | methyl 5-methoxy-2-[3-(2-methylpiperazine-1-carbonyl)phenyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 154903926 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | methyl 5-methoxy-2-[3-(2-methylpiperazine-1-carbonyl)phenyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1cc(OC)ccc1-c1cccc(C(=O)N2CCNCC2C)c1.Cl |
| InChI | InChI=1S/C21H24N2O4.ClH/c1-14-13-22-9-10-23(14)20(24)16-6-4-5-15(11-16)18-8-7-17(26-2)12-19(18)21(25)27-3;/h4-8,11-12,14,22H,9-10,13H2,1-3H3;1H |
| InChIKey | WVQBLJOYYQEDTA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |