C11H19NO2 — CID 12171821
2-(N,N-dimethyl-2-carbamoylethyl) cyclohexanone (PubChem CID 12171821) has the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-oxocyclohexyl)propanamide.
| Compound Name | 2-(N,N-dimethyl-2-carbamoylethyl) cyclohexanone |
|---|---|
| PubChem CID | 12171821 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N,N-dimethyl-3-(2-oxocyclohexyl)propanamide |
| SMILES | CN(C)C(=O)CCC1CCCCC1=O |
| InChI | InChI=1S/C11H19NO2/c1-12(2)11(14)8-7-9-5-3-4-6-10(9)13/h9H,3-8H2,1-2H3 |
| InChIKey | ZCXBGTDFGZCVCK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 37.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 223 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |