C19H16N6O3 — CID 1217470
(7S)-7-(1,3-benzodioxol-5-yl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 1217470) has the molecular formula C19H16N6O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is (7S)-7-(1,3-benzodioxol-5-yl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-7-(1,3-benzodioxol-5-yl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 1217470 |
| Molecular Formula | C19H16N6O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (7S)-7-(1,3-benzodioxol-5-yl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccn2)[C@H](c2ccc3c(c2)OCO3)n2ncnc2N1 |
| InChI | InChI=1S/C19H16N6O3/c1-11-16(18(26)24-15-4-2-3-7-20-15)17(25-19(23-11)21-9-22-25)12-5-6-13-14(8-12)28-10-27-13/h2-9,17H,10H2,1H3,(H,20,24,26)(H,21,22,23)/t17-/m0/s1 |
| InChIKey | KMMJDOKKNALYOI-KRWDZBQOSA-N |
| XLogP | 2.33 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |